About 1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine
1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine (PubChem CID 12579225) has the molecular formula C17H24N2O2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine.
Molecular Properties
| Compound Name | 1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine |
| PubChem CID | 12579225 |
| Molecular Formula | C17H24N2O2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.18 |
| IUPAC Name | 1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine |
| SMILES | COc1cc(NCCCC(C)N)c2ccccc2c1OC |
| InChI | InChI=1S/C17H24N2O2/c1-12(18)7-6-10-19-15-11-16(20-2)17(21-3)14-9-5-4-8-13(14)15/h4-5,8-9,11-12,19H,6-7,10,18H2,1-3H3 |
| InChIKey | ARYBLGQDLHRNOB-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine?
The IUPAC name of 1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine (CID 12579225) is 1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine.
What is the SMILES notation for 1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine?
The canonical SMILES for 1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine is COc1cc(NCCCC(C)N)c2ccccc2c1OC.
What is the InChIKey of 1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine?
The InChIKey is ARYBLGQDLHRNOB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O2/c1-12(18)7-6-10-19-15-11-16(20-2)17(21-3)14-9-5-4-8-13(14)15/h4-5,8-9,11-12,19H,6-7,10,18H2,1-3H3.
What are the key properties of 1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine?
1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine has a molecular weight of 288.39 g/mol, XLogP of 3.40, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N-(3,4-dimethoxynaphthalen-1-yl)pentane-1,4-diamine is sourced from PubChem (CID 12579225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).