About N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide
N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide (PubChem CID 1257994) has the molecular formula C18H16N2O2
and a molecular weight of 292.34 g/mol. Its IUPAC name is N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide.
Molecular Properties
| Compound Name | N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide |
| PubChem CID | 1257994 |
| Molecular Formula | C18H16N2O2 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.12 |
| IUPAC Name | N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide |
| SMILES | Cc1cc(-c2ccccc2C(=O)NCc2ccccc2)on1 |
| InChI | InChI=1S/C18H16N2O2/c1-13-11-17(22-20-13)15-9-5-6-10-16(15)18(21)19-12-14-7-3-2-4-8-14/h2-11H,12H2,1H3,(H,19,21) |
| InChIKey | QDGHHFSZVQMVAP-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide?
The IUPAC name of N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide (CID 1257994) is N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide.
What is the SMILES notation for N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide?
The canonical SMILES for N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide is Cc1cc(-c2ccccc2C(=O)NCc2ccccc2)on1.
What is the InChIKey of N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide?
The InChIKey is QDGHHFSZVQMVAP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O2/c1-13-11-17(22-20-13)15-9-5-6-10-16(15)18(21)19-12-14-7-3-2-4-8-14/h2-11H,12H2,1H3,(H,19,21).
What are the key properties of N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide?
N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide has a molecular weight of 292.34 g/mol, XLogP of 3.58, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-2-(3-methyl-1,2-oxazol-5-yl)benzamide is sourced from PubChem (CID 1257994), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).