About 1-bromo-2-butylbenzene
1-bromo-2-butylbenzene (PubChem CID 12580694) has the molecular formula C10H13Br
and a molecular weight of 213.12 g/mol. Its IUPAC name is 1-bromo-2-butylbenzene.
Molecular Properties
| Compound Name | 1-bromo-2-butylbenzene |
| PubChem CID | 12580694 |
| Molecular Formula | C10H13Br |
| Molecular Weight | 213.12 g/mol |
| Exact Mass | 212.02 |
| IUPAC Name | 1-bromo-2-butylbenzene |
| SMILES | CCCCc1ccccc1Br |
| InChI | InChI=1S/C10H13Br/c1-2-3-6-9-7-4-5-8-10(9)11/h4-5,7-8H,2-3,6H2,1H3 |
| InChIKey | UEVKWTASYVIROP-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.12 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-bromo-2-butylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-bromo-2-butylbenzene?
The IUPAC name of 1-bromo-2-butylbenzene (CID 12580694) is 1-bromo-2-butylbenzene.
What is the SMILES notation for 1-bromo-2-butylbenzene?
The canonical SMILES for 1-bromo-2-butylbenzene is CCCCc1ccccc1Br.
What is the InChIKey of 1-bromo-2-butylbenzene?
The InChIKey is UEVKWTASYVIROP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13Br/c1-2-3-6-9-7-4-5-8-10(9)11/h4-5,7-8H,2-3,6H2,1H3.
What are the key properties of 1-bromo-2-butylbenzene?
1-bromo-2-butylbenzene has a molecular weight of 213.12 g/mol, XLogP of 3.79, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-bromo-2-butylbenzene is sourced from PubChem (CID 12580694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).