C12H24N2O — CID 12580995
1-tert-butyl-3,3,5,5-tetramethylpiperazin-2-one (PubChem CID 12580995) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 1-tert-butyl-3,3,5,5-tetramethylpiperazin-2-one.
| Compound Name | 1-tert-butyl-3,3,5,5-tetramethylpiperazin-2-one |
|---|---|
| PubChem CID | 12580995 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 1-tert-butyl-3,3,5,5-tetramethylpiperazin-2-one |
| SMILES | CC1(C)CN(C(C)(C)C)C(=O)C(C)(C)N1 |
| InChI | InChI=1S/C12H24N2O/c1-10(2,3)14-8-11(4,5)13-12(6,7)9(14)15/h13H,8H2,1-7H3 |
| InChIKey | YDNIYVWPLJWOEF-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |