About 1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione
1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione (PubChem CID 12581067) has the molecular formula C10H12N2O2S4
and a molecular weight of 320.49 g/mol. Its IUPAC name is 1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione.
Molecular Properties
| Compound Name | 1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione |
| PubChem CID | 12581067 |
| Molecular Formula | C10H12N2O2S4 |
| Molecular Weight | 320.49 g/mol |
| Exact Mass | 319.98 |
| IUPAC Name | 1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCSC1=S)N1CCSC1=S |
| InChI | InChI=1S/C10H12N2O2S4/c13-7(11-3-5-17-9(11)15)1-2-8(14)12-4-6-18-10(12)16/h1-6H2 |
| InChIKey | DWHPCLYGCSTFJJ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.49 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione?
The IUPAC name of 1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione (CID 12581067) is 1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione.
What is the SMILES notation for 1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione?
The canonical SMILES for 1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione is O=C(CCC(=O)N1CCSC1=S)N1CCSC1=S.
What is the InChIKey of 1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione?
The InChIKey is DWHPCLYGCSTFJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O2S4/c13-7(11-3-5-17-9(11)15)1-2-8(14)12-4-6-18-10(12)16/h1-6H2.
What are the key properties of 1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione?
1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione has a molecular weight of 320.49 g/mol, XLogP of 1.49, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-bis(2-sulfanylidene-1,3-thiazolidin-3-yl)butane-1,4-dione is sourced from PubChem (CID 12581067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).