About 2-methyl-5-phenyl-1,2,4-triazol-3-amine
2-methyl-5-phenyl-1,2,4-triazol-3-amine (PubChem CID 12581307) has the molecular formula C9H10N4
and a molecular weight of 174.21 g/mol. Its IUPAC name is 2-methyl-5-phenyl-1,2,4-triazol-3-amine.
Molecular Properties
| Compound Name | 2-methyl-5-phenyl-1,2,4-triazol-3-amine |
| PubChem CID | 12581307 |
| Molecular Formula | C9H10N4 |
| Molecular Weight | 174.21 g/mol |
| Exact Mass | 174.09 |
| IUPAC Name | 2-methyl-5-phenyl-1,2,4-triazol-3-amine |
| SMILES | Cn1nc(-c2ccccc2)nc1N |
| InChI | InChI=1S/C9H10N4/c1-13-9(10)11-8(12-13)7-5-3-2-4-6-7/h2-6H,1H3,(H2,10,11,12) |
| InChIKey | HRLKLZWPSVFXAC-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methyl-5-phenyl-1,2,4-triazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-5-phenyl-1,2,4-triazol-3-amine?
The IUPAC name of 2-methyl-5-phenyl-1,2,4-triazol-3-amine (CID 12581307) is 2-methyl-5-phenyl-1,2,4-triazol-3-amine.
What is the SMILES notation for 2-methyl-5-phenyl-1,2,4-triazol-3-amine?
The canonical SMILES for 2-methyl-5-phenyl-1,2,4-triazol-3-amine is Cn1nc(-c2ccccc2)nc1N.
What is the InChIKey of 2-methyl-5-phenyl-1,2,4-triazol-3-amine?
The InChIKey is HRLKLZWPSVFXAC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4/c1-13-9(10)11-8(12-13)7-5-3-2-4-6-7/h2-6H,1H3,(H2,10,11,12).
What are the key properties of 2-methyl-5-phenyl-1,2,4-triazol-3-amine?
2-methyl-5-phenyl-1,2,4-triazol-3-amine has a molecular weight of 174.21 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-5-phenyl-1,2,4-triazol-3-amine is sourced from PubChem (CID 12581307), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).