About spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane]
spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane] (PubChem CID 12581317) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane].
Molecular Properties
| Compound Name | spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane] |
| PubChem CID | 12581317 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane] |
| SMILES | C1COC2(CC3C4OC4CC32)O1 |
| InChI | InChI=1S/C9H12O3/c1-2-11-9(10-1)4-5-6(9)3-7-8(5)12-7/h5-8H,1-4H2 |
| InChIKey | IHFHTGNFDZHEGR-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane]?
The IUPAC name of spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane] (CID 12581317) is spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane].
What is the SMILES notation for spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane]?
The canonical SMILES for spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane] is C1COC2(CC3C4OC4CC32)O1.
What is the InChIKey of spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane]?
The InChIKey is IHFHTGNFDZHEGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c1-2-11-9(10-1)4-5-6(9)3-7-8(5)12-7/h5-8H,1-4H2.
What are the key properties of spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane]?
spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane] has a molecular weight of 168.19 g/mol, XLogP of 0.54, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane] is sourced from PubChem (CID 12581317), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).