C9H12O3 — CID 12581319
(1'R,2'S,4'R,6'R)-spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane] (PubChem CID 12581319) has the molecular formula C9H12O3 and a molecular weight of 168.19 g/mol. Its IUPAC name is (1'R,2'S,4'R,6'R)-spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane].
| Compound Name | (1'R,2'S,4'R,6'R)-spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane] |
|---|---|
| PubChem CID | 12581319 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | (1'R,2'S,4'R,6'R)-spiro[1,3-dioxolane-2,7'-3-oxatricyclo[4.2.0.02,4]octane] |
| SMILES | C1COC2(C[C@H]3[C@@H]4O[C@@H]4C[C@H]32)O1 |
| InChI | InChI=1S/C9H12O3/c1-2-11-9(10-1)4-5-6(9)3-7-8(5)12-7/h5-8H,1-4H2/t5-,6-,7-,8+/m1/s1 |
| InChIKey | IHFHTGNFDZHEGR-XUTVFYLZSA-N |
| XLogP | 0.54 |
| TPSA | 30.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|