About 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine
2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (PubChem CID 12581391) has the molecular formula C7H8N4
and a molecular weight of 148.17 g/mol. Its IUPAC name is 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine.
Analyze 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine?
The IUPAC name of 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine (CID 12581391) is 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine.
What is the SMILES notation for 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine?
The canonical SMILES for 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine is Cc1ccn2nc(C)nc2n1.
What is the InChIKey of 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine?
The InChIKey is RWJDANBKQBNXSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4/c1-5-3-4-11-7(8-5)9-6(2)10-11/h3-4H,1-2H3.
What are the key properties of 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine?
2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine has a molecular weight of 148.17 g/mol, XLogP of 0.74, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidine is sourced from PubChem (CID 12581391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).