About 4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine
4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine (PubChem CID 12581462) has the molecular formula C15H21NS
and a molecular weight of 247.41 g/mol. Its IUPAC name is 4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine |
| PubChem CID | 12581462 |
| Molecular Formula | C15H21NS |
| Molecular Weight | 247.41 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine |
| SMILES | CCC1=CN(C)CCC1SCc1ccccc1 |
| InChI | InChI=1S/C15H21NS/c1-3-14-11-16(2)10-9-15(14)17-12-13-7-5-4-6-8-13/h4-8,11,15H,3,9-10,12H2,1-2H3 |
| InChIKey | HSILEVJILPNBGZ-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 247.41 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine?
The IUPAC name of 4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine (CID 12581462) is 4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine.
What is the SMILES notation for 4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine?
The canonical SMILES for 4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine is CCC1=CN(C)CCC1SCc1ccccc1.
What is the InChIKey of 4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine?
The InChIKey is HSILEVJILPNBGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H21NS/c1-3-14-11-16(2)10-9-15(14)17-12-13-7-5-4-6-8-13/h4-8,11,15H,3,9-10,12H2,1-2H3.
What are the key properties of 4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine?
4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine has a molecular weight of 247.41 g/mol, XLogP of 3.92, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzylsulfanyl-5-ethyl-1-methyl-3,4-dihydro-2H-pyridine is sourced from PubChem (CID 12581462), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).