C24H40O8 — CID 12581605
1,4,15,18-tetraoxacyclooctacosane-5,14,19,28-tetrone (PubChem CID 12581605) has the molecular formula C24H40O8 and a molecular weight of 456.58 g/mol. Its IUPAC name is 1,4,15,18-tetraoxacyclooctacosane-5,14,19,28-tetrone.
| Compound Name | 1,4,15,18-tetraoxacyclooctacosane-5,14,19,28-tetrone |
|---|---|
| PubChem CID | 12581605 |
| Molecular Formula | C24H40O8 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | 1,4,15,18-tetraoxacyclooctacosane-5,14,19,28-tetrone |
| SMILES | O=C1CCCCCCCCC(=O)OCCOC(=O)CCCCCCCCC(=O)OCCO1 |
| InChI | InChI=1S/C24H40O8/c25-21-13-9-5-1-2-6-10-14-22(26)30-19-20-32-24(28)16-12-8-4-3-7-11-15-23(27)31-18-17-29-21/h1-20H2 |
| InChIKey | AMGBSKXAVWNRGS-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|