About 2-chloro-4,5-dimethylpyrimidine
2-chloro-4,5-dimethylpyrimidine (PubChem CID 12581784) has the molecular formula C6H7ClN2
and a molecular weight of 142.59 g/mol. Its IUPAC name is 2-chloro-4,5-dimethylpyrimidine.
Molecular Properties
| Compound Name | 2-chloro-4,5-dimethylpyrimidine |
| PubChem CID | 12581784 |
| Molecular Formula | C6H7ClN2 |
| Molecular Weight | 142.59 g/mol |
| Exact Mass | 142.03 |
| IUPAC Name | 2-chloro-4,5-dimethylpyrimidine |
| SMILES | Cc1cnc(Cl)nc1C |
| InChI | InChI=1S/C6H7ClN2/c1-4-3-8-6(7)9-5(4)2/h3H,1-2H3 |
| InChIKey | DBQFXQNGQUPVER-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.59 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-4,5-dimethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,5-dimethylpyrimidine?
The IUPAC name of 2-chloro-4,5-dimethylpyrimidine (CID 12581784) is 2-chloro-4,5-dimethylpyrimidine.
What is the SMILES notation for 2-chloro-4,5-dimethylpyrimidine?
The canonical SMILES for 2-chloro-4,5-dimethylpyrimidine is Cc1cnc(Cl)nc1C.
What is the InChIKey of 2-chloro-4,5-dimethylpyrimidine?
The InChIKey is DBQFXQNGQUPVER-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2/c1-4-3-8-6(7)9-5(4)2/h3H,1-2H3.
What are the key properties of 2-chloro-4,5-dimethylpyrimidine?
2-chloro-4,5-dimethylpyrimidine has a molecular weight of 142.59 g/mol, XLogP of 1.75, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,5-dimethylpyrimidine is sourced from PubChem (CID 12581784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).