About methyl 2-(2-methyl-1,3-dithian-2-yl)acetate
methyl 2-(2-methyl-1,3-dithian-2-yl)acetate (PubChem CID 12582316) has the molecular formula C8H14O2S2
and a molecular weight of 206.33 g/mol. Its IUPAC name is methyl 2-(2-methyl-1,3-dithian-2-yl)acetate.
Molecular Properties
| Compound Name | methyl 2-(2-methyl-1,3-dithian-2-yl)acetate |
| PubChem CID | 12582316 |
| Molecular Formula | C8H14O2S2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.04 |
| IUPAC Name | methyl 2-(2-methyl-1,3-dithian-2-yl)acetate |
| SMILES | COC(=O)CC1(C)SCCCS1 |
| InChI | InChI=1S/C8H14O2S2/c1-8(6-7(9)10-2)11-4-3-5-12-8/h3-6H2,1-2H3 |
| InChIKey | OFERBUQBWCVLQP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 2-(2-methyl-1,3-dithian-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-(2-methyl-1,3-dithian-2-yl)acetate?
The IUPAC name of methyl 2-(2-methyl-1,3-dithian-2-yl)acetate (CID 12582316) is methyl 2-(2-methyl-1,3-dithian-2-yl)acetate.
What is the SMILES notation for methyl 2-(2-methyl-1,3-dithian-2-yl)acetate?
The canonical SMILES for methyl 2-(2-methyl-1,3-dithian-2-yl)acetate is COC(=O)CC1(C)SCCCS1.
What is the InChIKey of methyl 2-(2-methyl-1,3-dithian-2-yl)acetate?
The InChIKey is OFERBUQBWCVLQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O2S2/c1-8(6-7(9)10-2)11-4-3-5-12-8/h3-6H2,1-2H3.
What are the key properties of methyl 2-(2-methyl-1,3-dithian-2-yl)acetate?
methyl 2-(2-methyl-1,3-dithian-2-yl)acetate has a molecular weight of 206.33 g/mol, XLogP of 2.14, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-(2-methyl-1,3-dithian-2-yl)acetate is sourced from PubChem (CID 12582316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).