C17H20ClN3 — CID 12582350
3-(1,2-diphenylethyl)-1,2,5,6-tetrahydro-1,2,4-triazine;hydrochloride (PubChem CID 12582350) has the molecular formula C17H20ClN3 and a molecular weight of 301.82 g/mol. Its IUPAC name is 3-(1,2-diphenylethyl)-1,2,5,6-tetrahydro-1,2,4-triazine;hydrochloride.
| Compound Name | 3-(1,2-diphenylethyl)-1,2,5,6-tetrahydro-1,2,4-triazine;hydrochloride |
|---|---|
| PubChem CID | 12582350 |
| Molecular Formula | C17H20ClN3 |
| Molecular Weight | 301.82 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 3-(1,2-diphenylethyl)-1,2,5,6-tetrahydro-1,2,4-triazine;hydrochloride |
| SMILES | Cl.c1ccc(CC(C2=NCCNN2)c2ccccc2)cc1 |
| InChI | InChI=1S/C17H19N3.ClH/c1-3-7-14(8-4-1)13-16(15-9-5-2-6-10-15)17-18-11-12-19-20-17;/h1-10,16,19H,11-13H2,(H,18,20);1H |
| InChIKey | YQUAOWNIIVZNAK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.82 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |