C17H15N3O2 — CID 12582826
1,1'-dimethylspiro[3H-quinazoline-2,2'-indole]-3',4-dione (PubChem CID 12582826) has the molecular formula C17H15N3O2 and a molecular weight of 293.33 g/mol. Its IUPAC name is 1,1'-dimethylspiro[3H-quinazoline-2,2'-indole]-3',4-dione.
| Compound Name | 1,1'-dimethylspiro[3H-quinazoline-2,2'-indole]-3',4-dione |
|---|---|
| PubChem CID | 12582826 |
| Molecular Formula | C17H15N3O2 |
| Molecular Weight | 293.33 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | 1,1'-dimethylspiro[3H-quinazoline-2,2'-indole]-3',4-dione |
| SMILES | CN1c2ccccc2C(=O)NC12C(=O)c1ccccc1N2C |
| InChI | InChI=1S/C17H15N3O2/c1-19-13-9-5-3-7-11(13)15(21)17(19)18-16(22)12-8-4-6-10-14(12)20(17)2/h3-10H,1-2H3,(H,18,22) |
| InChIKey | KSRRPJVEGGNXPN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |