C9H19O4P — CID 12583349
2-(2,2-dimethylpropoxy)-4,5-dimethyl-1,3,2λ5-dioxaphospholane 2-oxide (PubChem CID 12583349) has the molecular formula C9H19O4P and a molecular weight of 222.22 g/mol. Its IUPAC name is 2-(2,2-dimethylpropoxy)-4,5-dimethyl-1,3,2λ5-dioxaphospholane 2-oxide.
| Compound Name | 2-(2,2-dimethylpropoxy)-4,5-dimethyl-1,3,2λ5-dioxaphospholane 2-oxide |
|---|---|
| PubChem CID | 12583349 |
| Molecular Formula | C9H19O4P |
| Molecular Weight | 222.22 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 2-(2,2-dimethylpropoxy)-4,5-dimethyl-1,3,2λ5-dioxaphospholane 2-oxide |
| SMILES | CC1OP(=O)(OCC(C)(C)C)OC1C |
| InChI | InChI=1S/C9H19O4P/c1-7-8(2)13-14(10,12-7)11-6-9(3,4)5/h7-8H,6H2,1-5H3 |
| InChIKey | SRLLBYRSXILQJJ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.22 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|