About 6-bromo-N,N-diethylhexan-1-amine;hydrobromide
6-bromo-N,N-diethylhexan-1-amine;hydrobromide (PubChem CID 12583380) has the molecular formula C10H23Br2N
and a molecular weight of 317.11 g/mol. Its IUPAC name is 6-bromo-N,N-diethylhexan-1-amine;hydrobromide.
Molecular Properties
| Compound Name | 6-bromo-N,N-diethylhexan-1-amine;hydrobromide |
| PubChem CID | 12583380 |
| Molecular Formula | C10H23Br2N |
| Molecular Weight | 317.11 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | 6-bromo-N,N-diethylhexan-1-amine;hydrobromide |
| SMILES | Br.CCN(CC)CCCCCCBr |
| InChI | InChI=1S/C10H22BrN.BrH/c1-3-12(4-2)10-8-6-5-7-9-11;/h3-10H2,1-2H3;1H |
| InChIKey | PEEFONXCSVHYIJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 317.11 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-N,N-diethylhexan-1-amine;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-N,N-diethylhexan-1-amine;hydrobromide?
The IUPAC name of 6-bromo-N,N-diethylhexan-1-amine;hydrobromide (CID 12583380) is 6-bromo-N,N-diethylhexan-1-amine;hydrobromide.
What is the SMILES notation for 6-bromo-N,N-diethylhexan-1-amine;hydrobromide?
The canonical SMILES for 6-bromo-N,N-diethylhexan-1-amine;hydrobromide is Br.CCN(CC)CCCCCCBr.
What is the InChIKey of 6-bromo-N,N-diethylhexan-1-amine;hydrobromide?
The InChIKey is PEEFONXCSVHYIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22BrN.BrH/c1-3-12(4-2)10-8-6-5-7-9-11;/h3-10H2,1-2H3;1H.
What are the key properties of 6-bromo-N,N-diethylhexan-1-amine;hydrobromide?
6-bromo-N,N-diethylhexan-1-amine;hydrobromide has a molecular weight of 317.11 g/mol, XLogP of 3.86, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-N,N-diethylhexan-1-amine;hydrobromide is sourced from PubChem (CID 12583380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).