About bromo(diethoxy)phosphane
bromo(diethoxy)phosphane (PubChem CID 12583901) has the molecular formula C4H10BrO2P
and a molecular weight of 201.00 g/mol. Its IUPAC name is bromo(diethoxy)phosphane.
Molecular Properties
| Compound Name | bromo(diethoxy)phosphane |
| PubChem CID | 12583901 |
| Molecular Formula | C4H10BrO2P |
| Molecular Weight | 201.00 g/mol |
| Exact Mass | 199.96 |
| IUPAC Name | bromo(diethoxy)phosphane |
| SMILES | CCOP(Br)OCC |
| InChI | InChI=1S/C4H10BrO2P/c1-3-6-8(5)7-4-2/h3-4H2,1-2H3 |
| InChIKey | NTJITRXLISEITA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.00 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze bromo(diethoxy)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromo(diethoxy)phosphane?
The IUPAC name of bromo(diethoxy)phosphane (CID 12583901) is bromo(diethoxy)phosphane.
What is the SMILES notation for bromo(diethoxy)phosphane?
The canonical SMILES for bromo(diethoxy)phosphane is CCOP(Br)OCC.
What is the InChIKey of bromo(diethoxy)phosphane?
The InChIKey is NTJITRXLISEITA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10BrO2P/c1-3-6-8(5)7-4-2/h3-4H2,1-2H3.
What are the key properties of bromo(diethoxy)phosphane?
bromo(diethoxy)phosphane has a molecular weight of 201.00 g/mol, XLogP of 2.68, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bromo(diethoxy)phosphane is sourced from PubChem (CID 12583901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).