C9F18 — CID 12584481
(E)-1,1,1,2,3,5,5,6,6,7,7,7-dodecafluoro-2,4-bis(trifluoromethyl)hept-3-ene (PubChem CID 12584481) has the molecular formula C9F18 and a molecular weight of 450.06 g/mol. Its IUPAC name is (E)-1,1,1,2,3,5,5,6,6,7,7,7-dodecafluoro-2,4-bis(trifluoromethyl)hept-3-ene.
| Compound Name | (E)-1,1,1,2,3,5,5,6,6,7,7,7-dodecafluoro-2,4-bis(trifluoromethyl)hept-3-ene |
|---|---|
| PubChem CID | 12584481 |
| Molecular Formula | C9F18 |
| Molecular Weight | 450.06 g/mol |
| Exact Mass | 449.97 |
| IUPAC Name | (E)-1,1,1,2,3,5,5,6,6,7,7,7-dodecafluoro-2,4-bis(trifluoromethyl)hept-3-ene |
| SMILES | F/C(=C(/C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9F18/c10-2(3(11,7(19,20)21)8(22,23)24)1(5(14,15)16)4(12,13)6(17,18)9(25,26)27/b2-1+ |
| InChIKey | GCESKVLWIQXBGA-OWOJBTEDSA-N |
| XLogP | 6.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.06 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|