C6H8F2 — CID 12584515
(3Z)-3-(difluoromethyl)penta-1,3-diene (PubChem CID 12584515) has the molecular formula C6H8F2 and a molecular weight of 118.13 g/mol. Its IUPAC name is (3Z)-3-(difluoromethyl)penta-1,3-diene.
| Compound Name | (3Z)-3-(difluoromethyl)penta-1,3-diene |
|---|---|
| PubChem CID | 12584515 |
| Molecular Formula | C6H8F2 |
| Molecular Weight | 118.13 g/mol |
| Exact Mass | 118.06 |
| IUPAC Name | (3Z)-3-(difluoromethyl)penta-1,3-diene |
| SMILES | C=C/C(=C/C)C(F)F |
| InChI | InChI=1S/C6H8F2/c1-3-5(4-2)6(7)8/h3-4,6H,1H2,2H3/b5-4- |
| InChIKey | VGUGFXYXSBVIIF-PLNGDYQASA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 118.13 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|