About 2,6-dimethylhept-5-enoic acid
2,6-dimethylhept-5-enoic acid (PubChem CID 12584678) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 2,6-dimethylhept-5-enoic acid.
Molecular Properties
| Compound Name | 2,6-dimethylhept-5-enoic acid |
| PubChem CID | 12584678 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 2,6-dimethylhept-5-enoic acid |
| SMILES | CC(C)=CCCC(C)C(=O)O |
| InChI | InChI=1S/C9H16O2/c1-7(2)5-4-6-8(3)9(10)11/h5,8H,4,6H2,1-3H3,(H,10,11) |
| InChIKey | YZGRYUUGPWDZTQ-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,6-dimethylhept-5-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethylhept-5-enoic acid?
The IUPAC name of 2,6-dimethylhept-5-enoic acid (CID 12584678) is 2,6-dimethylhept-5-enoic acid.
What is the SMILES notation for 2,6-dimethylhept-5-enoic acid?
The canonical SMILES for 2,6-dimethylhept-5-enoic acid is CC(C)=CCCC(C)C(=O)O.
What is the InChIKey of 2,6-dimethylhept-5-enoic acid?
The InChIKey is YZGRYUUGPWDZTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-7(2)5-4-6-8(3)9(10)11/h5,8H,4,6H2,1-3H3,(H,10,11).
What are the key properties of 2,6-dimethylhept-5-enoic acid?
2,6-dimethylhept-5-enoic acid has a molecular weight of 156.22 g/mol, XLogP of 2.45, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethylhept-5-enoic acid is sourced from PubChem (CID 12584678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).