About 4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol
4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol (PubChem CID 12584953) has the molecular formula C9H12O2
and a molecular weight of 152.19 g/mol. Its IUPAC name is 4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol.
Molecular Properties
| Compound Name | 4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol |
| PubChem CID | 12584953 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol |
| SMILES | OCC12OC3C4CC(CC41)C32 |
| InChI | InChI=1S/C9H12O2/c10-3-9-6-2-4-1-5(6)8(11-9)7(4)9/h4-8,10H,1-3H2 |
| InChIKey | BPDKTSOEXGRDCI-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol?
The IUPAC name of 4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol (CID 12584953) is 4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol.
What is the SMILES notation for 4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol?
The canonical SMILES for 4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol is OCC12OC3C4CC(CC41)C32.
What is the InChIKey of 4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol?
The InChIKey is BPDKTSOEXGRDCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O2/c10-3-9-6-2-4-1-5(6)8(11-9)7(4)9/h4-8,10H,1-3H2.
What are the key properties of 4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol?
4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol has a molecular weight of 152.19 g/mol, XLogP of 0.40, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxatetracyclo[4.2.1.02,5.03,7]nonan-3-ylmethanol is sourced from PubChem (CID 12584953), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).