About 3-phenylpyrrole-2,5-dione
3-phenylpyrrole-2,5-dione (PubChem CID 12585297) has the molecular formula C10H7NO2
and a molecular weight of 173.17 g/mol. Its IUPAC name is 3-phenylpyrrole-2,5-dione.
Molecular Properties
| Compound Name | 3-phenylpyrrole-2,5-dione |
| PubChem CID | 12585297 |
| Molecular Formula | C10H7NO2 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.05 |
| IUPAC Name | 3-phenylpyrrole-2,5-dione |
| SMILES | O=C1C=C(c2ccccc2)C(=O)N1 |
| InChI | InChI=1S/C10H7NO2/c12-9-6-8(10(13)11-9)7-4-2-1-3-5-7/h1-6H,(H,11,12,13) |
| InChIKey | IYMZEPRSPLASMS-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 3-phenylpyrrole-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenylpyrrole-2,5-dione?
The IUPAC name of 3-phenylpyrrole-2,5-dione (CID 12585297) is 3-phenylpyrrole-2,5-dione.
What is the SMILES notation for 3-phenylpyrrole-2,5-dione?
The canonical SMILES for 3-phenylpyrrole-2,5-dione is O=C1C=C(c2ccccc2)C(=O)N1.
What is the InChIKey of 3-phenylpyrrole-2,5-dione?
The InChIKey is IYMZEPRSPLASMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO2/c12-9-6-8(10(13)11-9)7-4-2-1-3-5-7/h1-6H,(H,11,12,13).
What are the key properties of 3-phenylpyrrole-2,5-dione?
3-phenylpyrrole-2,5-dione has a molecular weight of 173.17 g/mol, XLogP of 0.73, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenylpyrrole-2,5-dione is sourced from PubChem (CID 12585297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).