About 2,6-diaminophenalen-1-one
2,6-diaminophenalen-1-one (PubChem CID 12586665) has the molecular formula C13H10N2O
and a molecular weight of 210.24 g/mol. Its IUPAC name is 2,6-diaminophenalen-1-one.
Molecular Properties
| Compound Name | 2,6-diaminophenalen-1-one |
| PubChem CID | 12586665 |
| Molecular Formula | C13H10N2O |
| Molecular Weight | 210.24 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 2,6-diaminophenalen-1-one |
| SMILES | NC1=Cc2ccc(N)c3cccc(c23)C1=O |
| InChI | InChI=1S/C13H10N2O/c14-10-5-4-7-6-11(15)13(16)9-3-1-2-8(10)12(7)9/h1-6H,14-15H2 |
| InChIKey | WJXJZMYSRQCZRG-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.24 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,6-diaminophenalen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diaminophenalen-1-one?
The IUPAC name of 2,6-diaminophenalen-1-one (CID 12586665) is 2,6-diaminophenalen-1-one.
What is the SMILES notation for 2,6-diaminophenalen-1-one?
The canonical SMILES for 2,6-diaminophenalen-1-one is NC1=Cc2ccc(N)c3cccc(c23)C1=O.
What is the InChIKey of 2,6-diaminophenalen-1-one?
The InChIKey is WJXJZMYSRQCZRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O/c14-10-5-4-7-6-11(15)13(16)9-3-1-2-8(10)12(7)9/h1-6H,14-15H2.
What are the key properties of 2,6-diaminophenalen-1-one?
2,6-diaminophenalen-1-one has a molecular weight of 210.24 g/mol, XLogP of 1.92, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diaminophenalen-1-one is sourced from PubChem (CID 12586665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).