C16H19F3O4Se — CID 12586995
diethyl 2-(3,3,3-trifluoro-2-phenylselanylpropyl)propanedioate (PubChem CID 12586995) has the molecular formula C16H19F3O4Se and a molecular weight of 411.28 g/mol. Its IUPAC name is diethyl 2-(3,3,3-trifluoro-2-phenylselanylpropyl)propanedioate.
| Compound Name | diethyl 2-(3,3,3-trifluoro-2-phenylselanylpropyl)propanedioate |
|---|---|
| PubChem CID | 12586995 |
| Molecular Formula | C16H19F3O4Se |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 412.04 |
| IUPAC Name | diethyl 2-(3,3,3-trifluoro-2-phenylselanylpropyl)propanedioate |
| SMILES | CCOC(=O)C(CC([Se]c1ccccc1)C(F)(F)F)C(=O)OCC |
| InChI | InChI=1S/C16H19F3O4Se/c1-3-22-14(20)12(15(21)23-4-2)10-13(16(17,18)19)24-11-8-6-5-7-9-11/h5-9,12-13H,3-4,10H2,1-2H3 |
| InChIKey | DYZIRGRZLUEKMO-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|