About diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate
diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate (PubChem CID 12586996) has the molecular formula C16H18F2O4Se
and a molecular weight of 391.27 g/mol. Its IUPAC name is diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate.
Molecular Properties
| Compound Name | diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate |
| PubChem CID | 12586996 |
| Molecular Formula | C16H18F2O4Se |
| Molecular Weight | 391.27 g/mol |
| Exact Mass | 392.03 |
| IUPAC Name | diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate |
| SMILES | CCOC(=O)C(CC([Se]c1ccccc1)=C(F)F)C(=O)OCC |
| InChI | InChI=1S/C16H18F2O4Se/c1-3-21-15(19)12(16(20)22-4-2)10-13(14(17)18)23-11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3 |
| InChIKey | HCBCGHWRVZJDBC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate?
The IUPAC name of diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate (CID 12586996) is diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate.
What is the SMILES notation for diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate?
The canonical SMILES for diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate is CCOC(=O)C(CC([Se]c1ccccc1)=C(F)F)C(=O)OCC.
What is the InChIKey of diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate?
The InChIKey is HCBCGHWRVZJDBC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18F2O4Se/c1-3-21-15(19)12(16(20)22-4-2)10-13(14(17)18)23-11-8-6-5-7-9-11/h5-9,12H,3-4,10H2,1-2H3.
What are the key properties of diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate?
diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate has a molecular weight of 391.27 g/mol, XLogP of 2.26, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-(3,3-difluoro-2-phenylselanylprop-2-enyl)propanedioate is sourced from PubChem (CID 12586996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).