C25H24N6O5 — CID 1258748
[3,5-bis[(2-methoxyphenyl)methylamino]-1,2,4-triazol-1-yl]-(4-nitrophenyl)methanone (PubChem CID 1258748) has the molecular formula C25H24N6O5 and a molecular weight of 488.50 g/mol. Its IUPAC name is [3,5-bis[(2-methoxyphenyl)methylamino]-1,2,4-triazol-1-yl]-(4-nitrophenyl)methanone.
| Compound Name | [3,5-bis[(2-methoxyphenyl)methylamino]-1,2,4-triazol-1-yl]-(4-nitrophenyl)methanone |
|---|---|
| PubChem CID | 1258748 |
| Molecular Formula | C25H24N6O5 |
| Molecular Weight | 488.50 g/mol |
| Exact Mass | 488.18 |
| IUPAC Name | [3,5-bis[(2-methoxyphenyl)methylamino]-1,2,4-triazol-1-yl]-(4-nitrophenyl)methanone |
| SMILES | COc1ccccc1CNc1nc(NCc2ccccc2OC)n(C(=O)c2ccc([N+](=O)[O-])cc2)n1 |
| InChI | InChI=1S/C25H24N6O5/c1-35-21-9-5-3-7-18(21)15-26-24-28-25(27-16-19-8-4-6-10-22(19)36-2)30(29-24)23(32)17-11-13-20(14-12-17)31(33)34/h3-14H,15-16H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | LPGVMBVEDMRURN-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 133.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.50 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|