About 2-methylpropyl octadecanoate
2-methylpropyl octadecanoate (PubChem CID 12588) has the molecular formula C22H44O2
and a molecular weight of 340.59 g/mol. Its IUPAC name is 2-methylpropyl octadecanoate.
Molecular Properties
| Compound Name | 2-methylpropyl octadecanoate |
| PubChem CID | 12588 |
| Molecular Formula | C22H44O2 |
| Molecular Weight | 340.59 g/mol |
| Exact Mass | 340.33 |
| IUPAC Name | 2-methylpropyl octadecanoate |
| SMILES | CCCCCCCCCCCCCCCCCC(=O)OCC(C)C |
| InChI | InChI=1S/C22H44O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(23)24-20-21(2)3/h21H,4-20H2,1-3H3 |
| InChIKey | ORFWYUFLWUWSFM-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.59 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropyl octadecanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropyl octadecanoate?
The IUPAC name of 2-methylpropyl octadecanoate (CID 12588) is 2-methylpropyl octadecanoate.
What is the SMILES notation for 2-methylpropyl octadecanoate?
The canonical SMILES for 2-methylpropyl octadecanoate is CCCCCCCCCCCCCCCCCC(=O)OCC(C)C.
What is the InChIKey of 2-methylpropyl octadecanoate?
The InChIKey is ORFWYUFLWUWSFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H44O2/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-22(23)24-20-21(2)3/h21H,4-20H2,1-3H3.
What are the key properties of 2-methylpropyl octadecanoate?
2-methylpropyl octadecanoate has a molecular weight of 340.59 g/mol, XLogP of 7.45, 18 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropyl octadecanoate is sourced from PubChem (CID 12588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).