2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid

C7H9NO3S — CID 12588241

IUPAC2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid
SMILESCc1onc(SCC(=O)O)c1C
InChIInChI=1S/C7H9NO3S/c1-4-5(2)11-8-7(4)12-3-6(9)10/h3H2,1-2H3,(H,9,10)
InChIKeyBJWDHDWVZSOVQE-UHFFFAOYSA-N
MW187.22 g/mol
LogP1.47
Rot. Bonds3

About 2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid

2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid (PubChem CID 12588241) has the molecular formula C7H9NO3S and a molecular weight of 187.22 g/mol. Its IUPAC name is 2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid.

Molecular Properties

Compound Name2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid
PubChem CID12588241
Molecular FormulaC7H9NO3S
Molecular Weight187.22 g/mol
Exact Mass187.03
IUPAC Name2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid
SMILESCc1onc(SCC(=O)O)c1C
InChIInChI=1S/C7H9NO3S/c1-4-5(2)11-8-7(4)12-3-6(9)10/h3H2,1-2H3,(H,9,10)
InChIKeyBJWDHDWVZSOVQE-UHFFFAOYSA-N
XLogP1.47
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500187.22
LogP ≤ 51.47
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid?
The IUPAC name of 2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid (CID 12588241) is 2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid.
What is the SMILES notation for 2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid?
The canonical SMILES for 2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid is Cc1onc(SCC(=O)O)c1C.
What is the InChIKey of 2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid?
The InChIKey is BJWDHDWVZSOVQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H9NO3S/c1-4-5(2)11-8-7(4)12-3-6(9)10/h3H2,1-2H3,(H,9,10).
What are the key properties of 2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid?
2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid has a molecular weight of 187.22 g/mol, XLogP of 1.47, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4,5-dimethyl-1,2-oxazol-3-yl)sulfanyl]acetic acid is sourced from PubChem (CID 12588241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).