C20H26N2 — CID 12588737
2-tert-butyl-4-N,4-N,8-N,8-N-tetramethyl-s-indacene-4,8-diamine (PubChem CID 12588737) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 2-tert-butyl-4-N,4-N,8-N,8-N-tetramethyl-s-indacene-4,8-diamine.
| Compound Name | 2-tert-butyl-4-N,4-N,8-N,8-N-tetramethyl-s-indacene-4,8-diamine |
|---|---|
| PubChem CID | 12588737 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 2-tert-butyl-4-N,4-N,8-N,8-N-tetramethyl-s-indacene-4,8-diamine |
| SMILES | CN(C)c1c2c(c(N(C)C)c3c1=CC=C3)=CC(C(C)(C)C)=C2 |
| InChI | InChI=1S/C20H26N2/c1-20(2,3)13-11-16-17(12-13)19(22(6)7)15-10-8-9-14(15)18(16)21(4)5/h8-12H,1-7H3 |
| InChIKey | ZZSGWKGDNLQCQC-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diaminobenzene_3', 'substructure': 'N/A'} |
|---|