About (3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile
(3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile (PubChem CID 12588987) has the molecular formula C10H17NOSi
and a molecular weight of 195.34 g/mol. Its IUPAC name is (3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile.
Molecular Properties
| Compound Name | (3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile |
| PubChem CID | 12588987 |
| Molecular Formula | C10H17NOSi |
| Molecular Weight | 195.34 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | (3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile |
| SMILES | C/C=C/C=C/C(C#N)O[Si](C)(C)C |
| InChI | InChI=1S/C10H17NOSi/c1-5-6-7-8-10(9-11)12-13(2,3)4/h5-8,10H,1-4H3/b6-5+,8-7+ |
| InChIKey | XETHDOWMTYGPLA-BSWSSELBSA-N |
| XLogP | 2.86 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile?
The IUPAC name of (3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile (CID 12588987) is (3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile.
What is the SMILES notation for (3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile?
The canonical SMILES for (3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile is C/C=C/C=C/C(C#N)O[Si](C)(C)C.
What is the InChIKey of (3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile?
The InChIKey is XETHDOWMTYGPLA-BSWSSELBSA-N. The full InChI is InChI=1S/C10H17NOSi/c1-5-6-7-8-10(9-11)12-13(2,3)4/h5-8,10H,1-4H3/b6-5+,8-7+.
What are the key properties of (3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile?
(3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile has a molecular weight of 195.34 g/mol, XLogP of 2.86, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3E,5E)-2-trimethylsilyloxyhepta-3,5-dienenitrile is sourced from PubChem (CID 12588987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).