About 1-pyrrol-1-yl-1,2,4-triazole
1-pyrrol-1-yl-1,2,4-triazole (PubChem CID 12589008) has the molecular formula C6H6N4
and a molecular weight of 134.14 g/mol. Its IUPAC name is 1-pyrrol-1-yl-1,2,4-triazole.
Molecular Properties
| Compound Name | 1-pyrrol-1-yl-1,2,4-triazole |
| PubChem CID | 12589008 |
| Molecular Formula | C6H6N4 |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | 1-pyrrol-1-yl-1,2,4-triazole |
| SMILES | c1ccn(-n2cncn2)c1 |
| InChI | InChI=1S/C6H6N4/c1-2-4-9(3-1)10-6-7-5-8-10/h1-6H |
| InChIKey | XNRLNLSBMCEYNC-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-pyrrol-1-yl-1,2,4-triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrol-1-yl-1,2,4-triazole?
The IUPAC name of 1-pyrrol-1-yl-1,2,4-triazole (CID 12589008) is 1-pyrrol-1-yl-1,2,4-triazole.
What is the SMILES notation for 1-pyrrol-1-yl-1,2,4-triazole?
The canonical SMILES for 1-pyrrol-1-yl-1,2,4-triazole is c1ccn(-n2cncn2)c1.
What is the InChIKey of 1-pyrrol-1-yl-1,2,4-triazole?
The InChIKey is XNRLNLSBMCEYNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6N4/c1-2-4-9(3-1)10-6-7-5-8-10/h1-6H.
What are the key properties of 1-pyrrol-1-yl-1,2,4-triazole?
1-pyrrol-1-yl-1,2,4-triazole has a molecular weight of 134.14 g/mol, XLogP of 0.39, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrol-1-yl-1,2,4-triazole is sourced from PubChem (CID 12589008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).