About N-phenylmethoxyaniline
N-phenylmethoxyaniline (PubChem CID 12589378) has the molecular formula C13H13NO
and a molecular weight of 199.25 g/mol. Its IUPAC name is N-phenylmethoxyaniline.
Molecular Properties
| Compound Name | N-phenylmethoxyaniline |
| PubChem CID | 12589378 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | N-phenylmethoxyaniline |
| SMILES | c1ccc(CONc2ccccc2)cc1 |
| InChI | InChI=1S/C13H13NO/c1-3-7-12(8-4-1)11-15-14-13-9-5-2-6-10-13/h1-10,14H,11H2 |
| InChIKey | KUVIRDUPAGKTER-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-phenylmethoxyaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-phenylmethoxyaniline?
The IUPAC name of N-phenylmethoxyaniline (CID 12589378) is N-phenylmethoxyaniline.
What is the SMILES notation for N-phenylmethoxyaniline?
The canonical SMILES for N-phenylmethoxyaniline is c1ccc(CONc2ccccc2)cc1.
What is the InChIKey of N-phenylmethoxyaniline?
The InChIKey is KUVIRDUPAGKTER-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13NO/c1-3-7-12(8-4-1)11-15-14-13-9-5-2-6-10-13/h1-10,14H,11H2.
What are the key properties of N-phenylmethoxyaniline?
N-phenylmethoxyaniline has a molecular weight of 199.25 g/mol, XLogP of 3.23, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-phenylmethoxyaniline is sourced from PubChem (CID 12589378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).