About methyl 2-azido-2-phenylacetate
methyl 2-azido-2-phenylacetate (PubChem CID 12590753) has the molecular formula C9H9N3O2
and a molecular weight of 191.19 g/mol. Its IUPAC name is methyl 2-azido-2-phenylacetate.
Molecular Properties
| Compound Name | methyl 2-azido-2-phenylacetate |
| PubChem CID | 12590753 |
| Molecular Formula | C9H9N3O2 |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.07 |
| IUPAC Name | methyl 2-azido-2-phenylacetate |
| SMILES | COC(=O)C(N=[N+]=[N-])c1ccccc1 |
| InChI | InChI=1S/C9H9N3O2/c1-14-9(13)8(11-12-10)7-5-3-2-4-6-7/h2-6,8H,1H3 |
| InChIKey | NZNCXBRHPGUHDG-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze methyl 2-azido-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-azido-2-phenylacetate?
The IUPAC name of methyl 2-azido-2-phenylacetate (CID 12590753) is methyl 2-azido-2-phenylacetate.
What is the SMILES notation for methyl 2-azido-2-phenylacetate?
The canonical SMILES for methyl 2-azido-2-phenylacetate is COC(=O)C(N=[N+]=[N-])c1ccccc1.
What is the InChIKey of methyl 2-azido-2-phenylacetate?
The InChIKey is NZNCXBRHPGUHDG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9N3O2/c1-14-9(13)8(11-12-10)7-5-3-2-4-6-7/h2-6,8H,1H3.
What are the key properties of methyl 2-azido-2-phenylacetate?
methyl 2-azido-2-phenylacetate has a molecular weight of 191.19 g/mol, XLogP of 2.21, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-azido-2-phenylacetate is sourced from PubChem (CID 12590753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).