About 4-(3-methylbutyl)aniline
4-(3-methylbutyl)aniline (PubChem CID 12590943) has the molecular formula C11H17N
and a molecular weight of 163.26 g/mol. Its IUPAC name is 4-(3-methylbutyl)aniline.
Molecular Properties
| Compound Name | 4-(3-methylbutyl)aniline |
| PubChem CID | 12590943 |
| Molecular Formula | C11H17N |
| Molecular Weight | 163.26 g/mol |
| Exact Mass | 163.14 |
| IUPAC Name | 4-(3-methylbutyl)aniline |
| SMILES | CC(C)CCc1ccc(N)cc1 |
| InChI | InChI=1S/C11H17N/c1-9(2)3-4-10-5-7-11(12)8-6-10/h5-9H,3-4,12H2,1-2H3 |
| InChIKey | JUXQDLFYTNOQRC-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-(3-methylbutyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-methylbutyl)aniline?
The IUPAC name of 4-(3-methylbutyl)aniline (CID 12590943) is 4-(3-methylbutyl)aniline.
What is the SMILES notation for 4-(3-methylbutyl)aniline?
The canonical SMILES for 4-(3-methylbutyl)aniline is CC(C)CCc1ccc(N)cc1.
What is the InChIKey of 4-(3-methylbutyl)aniline?
The InChIKey is JUXQDLFYTNOQRC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N/c1-9(2)3-4-10-5-7-11(12)8-6-10/h5-9H,3-4,12H2,1-2H3.
What are the key properties of 4-(3-methylbutyl)aniline?
4-(3-methylbutyl)aniline has a molecular weight of 163.26 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-methylbutyl)aniline is sourced from PubChem (CID 12590943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).