About ethyl 2-(ethylamino)acetate
ethyl 2-(ethylamino)acetate (PubChem CID 12591597) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is ethyl 2-(ethylamino)acetate.
Molecular Properties
| Compound Name | ethyl 2-(ethylamino)acetate |
| PubChem CID | 12591597 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | ethyl 2-(ethylamino)acetate |
| SMILES | CCNCC(=O)OCC |
| InChI | InChI=1S/C6H13NO2/c1-3-7-5-6(8)9-4-2/h7H,3-5H2,1-2H3 |
| InChIKey | NRMPJIHWGVBZBB-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 2-(ethylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-(ethylamino)acetate?
The IUPAC name of ethyl 2-(ethylamino)acetate (CID 12591597) is ethyl 2-(ethylamino)acetate.
What is the SMILES notation for ethyl 2-(ethylamino)acetate?
The canonical SMILES for ethyl 2-(ethylamino)acetate is CCNCC(=O)OCC.
What is the InChIKey of ethyl 2-(ethylamino)acetate?
The InChIKey is NRMPJIHWGVBZBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO2/c1-3-7-5-6(8)9-4-2/h7H,3-5H2,1-2H3.
What are the key properties of ethyl 2-(ethylamino)acetate?
ethyl 2-(ethylamino)acetate has a molecular weight of 131.18 g/mol, XLogP of 0.16, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-(ethylamino)acetate is sourced from PubChem (CID 12591597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).