About 2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene
2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene (PubChem CID 12591887) has the molecular formula C15H29O4P
and a molecular weight of 304.37 g/mol. Its IUPAC name is 2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene.
Molecular Properties
| Compound Name | 2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene |
| PubChem CID | 12591887 |
| Molecular Formula | C15H29O4P |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.18 |
| IUPAC Name | 2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene |
| SMILES | C=C(C(OC)=C(C)C)P(=O)(OCCCC)OCCCC |
| InChI | InChI=1S/C15H29O4P/c1-7-9-11-18-20(16,19-12-10-8-2)14(5)15(17-6)13(3)4/h5,7-12H2,1-4,6H3 |
| InChIKey | OQLNNXGMYYSVBT-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene?
The IUPAC name of 2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene (CID 12591887) is 2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene.
What is the SMILES notation for 2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene?
The canonical SMILES for 2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene is C=C(C(OC)=C(C)C)P(=O)(OCCCC)OCCCC.
What is the InChIKey of 2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene?
The InChIKey is OQLNNXGMYYSVBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H29O4P/c1-7-9-11-18-20(16,19-12-10-8-2)14(5)15(17-6)13(3)4/h5,7-12H2,1-4,6H3.
What are the key properties of 2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene?
2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene has a molecular weight of 304.37 g/mol, XLogP of 5.27, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-dibutoxyphosphoryl-3-methoxy-4-methylpenta-1,3-diene is sourced from PubChem (CID 12591887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).