About morpholine-4-carbonyl fluoride
morpholine-4-carbonyl fluoride (PubChem CID 12592126) has the molecular formula C5H8FNO2
and a molecular weight of 133.12 g/mol. Its IUPAC name is morpholine-4-carbonyl fluoride.
Molecular Properties
| Compound Name | morpholine-4-carbonyl fluoride |
| PubChem CID | 12592126 |
| Molecular Formula | C5H8FNO2 |
| Molecular Weight | 133.12 g/mol |
| Exact Mass | 133.05 |
| IUPAC Name | morpholine-4-carbonyl fluoride |
| SMILES | O=C(F)N1CCOCC1 |
| InChI | InChI=1S/C5H8FNO2/c6-5(8)7-1-3-9-4-2-7/h1-4H2 |
| InChIKey | RVZHTPNIIQLANL-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.12 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze morpholine-4-carbonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of morpholine-4-carbonyl fluoride?
The IUPAC name of morpholine-4-carbonyl fluoride (CID 12592126) is morpholine-4-carbonyl fluoride.
What is the SMILES notation for morpholine-4-carbonyl fluoride?
The canonical SMILES for morpholine-4-carbonyl fluoride is O=C(F)N1CCOCC1.
What is the InChIKey of morpholine-4-carbonyl fluoride?
The InChIKey is RVZHTPNIIQLANL-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8FNO2/c6-5(8)7-1-3-9-4-2-7/h1-4H2.
What are the key properties of morpholine-4-carbonyl fluoride?
morpholine-4-carbonyl fluoride has a molecular weight of 133.12 g/mol, XLogP of 0.41, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for morpholine-4-carbonyl fluoride is sourced from PubChem (CID 12592126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).