About ethyl (1S,6R)-2,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate
ethyl (1S,6R)-2,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate (PubChem CID 12592662) has the molecular formula C11H16O3
and a molecular weight of 196.25 g/mol. Its IUPAC name is ethyl (1S,6R)-2,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate.
Analyze ethyl (1S,6R)-2,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (1S,6R)-2,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate?
The IUPAC name of ethyl (1S,6R)-2,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate (CID 12592662) is ethyl (1S,6R)-2,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate.
What is the SMILES notation for ethyl (1S,6R)-2,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate?
The canonical SMILES for ethyl (1S,6R)-2,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate is CCOC(=O)[C@@H]1C(C)=CC(=O)C[C@H]1C.
What is the InChIKey of ethyl (1S,6R)-2,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate?
The InChIKey is FMQHLVMBLLFWPK-PSASIEDQSA-N. The full InChI is InChI=1S/C11H16O3/c1-4-14-11(13)10-7(2)5-9(12)6-8(10)3/h5,8,10H,4,6H2,1-3H3/t8-,10-/m1/s1.
What are the key properties of ethyl (1S,6R)-2,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate?
ethyl (1S,6R)-2,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate has a molecular weight of 196.25 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (1S,6R)-2,6-dimethyl-4-oxocyclohex-2-ene-1-carboxylate is sourced from PubChem (CID 12592662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).