C12H12N2OS — CID 12593079
8-amino-3,4-dihydro-2H-[1,3]thiazino[3,2-b]isoquinolin-6-one (PubChem CID 12593079) has the molecular formula C12H12N2OS and a molecular weight of 232.31 g/mol. Its IUPAC name is 8-amino-3,4-dihydro-2H-[1,3]thiazino[3,2-b]isoquinolin-6-one.
| Compound Name | 8-amino-3,4-dihydro-2H-[1,3]thiazino[3,2-b]isoquinolin-6-one |
|---|---|
| PubChem CID | 12593079 |
| Molecular Formula | C12H12N2OS |
| Molecular Weight | 232.31 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 8-amino-3,4-dihydro-2H-[1,3]thiazino[3,2-b]isoquinolin-6-one |
| SMILES | Nc1ccc2cc3n(c(=O)c2c1)CCCS3 |
| InChI | InChI=1S/C12H12N2OS/c13-9-3-2-8-6-11-14(4-1-5-16-11)12(15)10(8)7-9/h2-3,6-7H,1,4-5,13H2 |
| InChIKey | AACLSCNUODENLJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 48.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.31 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|