1-methylpiperidine;2,2,2-trifluoroacetic acid

C8H14F3NO2 — CID 12593400

IUPAC1-methylpiperidine;2,2,2-trifluoroacetic acid
SMILESCN1CCCCC1.O=C(O)C(F)(F)F
InChIInChI=1S/C6H13N.C2HF3O2/c1-7-5-3-2-4-6-7;3-2(4,5)1(6)7/h2-6H2,1H3;(H,6,7)
InChIKeyCVXUSUNJAFQWTI-UHFFFAOYSA-N
MW213.20 g/mol
LogP1.74
Rot. Bonds

About 1-methylpiperidine;2,2,2-trifluoroacetic acid

1-methylpiperidine;2,2,2-trifluoroacetic acid (PubChem CID 12593400) has the molecular formula C8H14F3NO2 and a molecular weight of 213.20 g/mol. Its IUPAC name is 1-methylpiperidine;2,2,2-trifluoroacetic acid.

Molecular Properties

Compound Name1-methylpiperidine;2,2,2-trifluoroacetic acid
PubChem CID12593400
Molecular FormulaC8H14F3NO2
Molecular Weight213.20 g/mol
Exact Mass213.10
IUPAC Name1-methylpiperidine;2,2,2-trifluoroacetic acid
SMILESCN1CCCCC1.O=C(O)C(F)(F)F
InChIInChI=1S/C6H13N.C2HF3O2/c1-7-5-3-2-4-6-7;3-2(4,5)1(6)7/h2-6H2,1H3;(H,6,7)
InChIKeyCVXUSUNJAFQWTI-UHFFFAOYSA-N
XLogP1.74
TPSA40.54 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500213.20
LogP ≤ 51.74
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-methylpiperidine;2,2,2-trifluoroacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methylpiperidine;2,2,2-trifluoroacetic acid?
The IUPAC name of 1-methylpiperidine;2,2,2-trifluoroacetic acid (CID 12593400) is 1-methylpiperidine;2,2,2-trifluoroacetic acid.
What is the SMILES notation for 1-methylpiperidine;2,2,2-trifluoroacetic acid?
The canonical SMILES for 1-methylpiperidine;2,2,2-trifluoroacetic acid is CN1CCCCC1.O=C(O)C(F)(F)F.
What is the InChIKey of 1-methylpiperidine;2,2,2-trifluoroacetic acid?
The InChIKey is CVXUSUNJAFQWTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13N.C2HF3O2/c1-7-5-3-2-4-6-7;3-2(4,5)1(6)7/h2-6H2,1H3;(H,6,7).
What are the key properties of 1-methylpiperidine;2,2,2-trifluoroacetic acid?
1-methylpiperidine;2,2,2-trifluoroacetic acid has a molecular weight of 213.20 g/mol, XLogP of 1.74, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpiperidine;2,2,2-trifluoroacetic acid is sourced from PubChem (CID 12593400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).