C10H6F12O2 — CID 12593537
[2,2,3,3,5,5,6,6,7,7,8,8-dodecafluoro-4-(hydroxymethyl)-1-bicyclo[2.2.2]octanyl]methanol (PubChem CID 12593537) has the molecular formula C10H6F12O2 and a molecular weight of 386.13 g/mol. Its IUPAC name is [2,2,3,3,5,5,6,6,7,7,8,8-dodecafluoro-4-(hydroxymethyl)-1-bicyclo[2.2.2]octanyl]methanol.
| Compound Name | [2,2,3,3,5,5,6,6,7,7,8,8-dodecafluoro-4-(hydroxymethyl)-1-bicyclo[2.2.2]octanyl]methanol |
|---|---|
| PubChem CID | 12593537 |
| Molecular Formula | C10H6F12O2 |
| Molecular Weight | 386.13 g/mol |
| Exact Mass | 386.02 |
| IUPAC Name | [2,2,3,3,5,5,6,6,7,7,8,8-dodecafluoro-4-(hydroxymethyl)-1-bicyclo[2.2.2]octanyl]methanol |
| SMILES | OCC12C(F)(F)C(F)(F)C(CO)(C(F)(F)C1(F)F)C(F)(F)C2(F)F |
| InChI | InChI=1S/C10H6F12O2/c11-5(12)3(1-23)6(13,14)9(19,20)4(2-24,8(5,17)18)10(21,22)7(3,15)16/h23-24H,1-2H2 |
| InChIKey | XDNWKIDPGZXMDK-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.13 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|