About 4,5-dipropyl-1H-imidazole
4,5-dipropyl-1H-imidazole (PubChem CID 12593760) has the molecular formula C9H16N2
and a molecular weight of 152.24 g/mol. Its IUPAC name is 4,5-dipropyl-1H-imidazole.
Molecular Properties
| Compound Name | 4,5-dipropyl-1H-imidazole |
| PubChem CID | 12593760 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | 4,5-dipropyl-1H-imidazole |
| SMILES | CCCc1nc[nH]c1CCC |
| InChI | InChI=1S/C9H16N2/c1-3-5-8-9(6-4-2)11-7-10-8/h7H,3-6H2,1-2H3,(H,10,11) |
| InChIKey | NYBUEQZKBJIDFL-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,5-dipropyl-1H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dipropyl-1H-imidazole?
The IUPAC name of 4,5-dipropyl-1H-imidazole (CID 12593760) is 4,5-dipropyl-1H-imidazole.
What is the SMILES notation for 4,5-dipropyl-1H-imidazole?
The canonical SMILES for 4,5-dipropyl-1H-imidazole is CCCc1nc[nH]c1CCC.
What is the InChIKey of 4,5-dipropyl-1H-imidazole?
The InChIKey is NYBUEQZKBJIDFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2/c1-3-5-8-9(6-4-2)11-7-10-8/h7H,3-6H2,1-2H3,(H,10,11).
What are the key properties of 4,5-dipropyl-1H-imidazole?
4,5-dipropyl-1H-imidazole has a molecular weight of 152.24 g/mol, XLogP of 2.31, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dipropyl-1H-imidazole is sourced from PubChem (CID 12593760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).