About methyl 2-methyl-4-oxohexanoate
methyl 2-methyl-4-oxohexanoate (PubChem CID 12593956) has the molecular formula C8H14O3
and a molecular weight of 158.20 g/mol. Its IUPAC name is methyl 2-methyl-4-oxohexanoate.
Molecular Properties
| Compound Name | methyl 2-methyl-4-oxohexanoate |
| PubChem CID | 12593956 |
| Molecular Formula | C8H14O3 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | methyl 2-methyl-4-oxohexanoate |
| SMILES | CCC(=O)CC(C)C(=O)OC |
| InChI | InChI=1S/C8H14O3/c1-4-7(9)5-6(2)8(10)11-3/h6H,4-5H2,1-3H3 |
| InChIKey | GHXIKMWOQBSQSN-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 2-methyl-4-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 2-methyl-4-oxohexanoate?
The IUPAC name of methyl 2-methyl-4-oxohexanoate (CID 12593956) is methyl 2-methyl-4-oxohexanoate.
What is the SMILES notation for methyl 2-methyl-4-oxohexanoate?
The canonical SMILES for methyl 2-methyl-4-oxohexanoate is CCC(=O)CC(C)C(=O)OC.
What is the InChIKey of methyl 2-methyl-4-oxohexanoate?
The InChIKey is GHXIKMWOQBSQSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14O3/c1-4-7(9)5-6(2)8(10)11-3/h6H,4-5H2,1-3H3.
What are the key properties of methyl 2-methyl-4-oxohexanoate?
methyl 2-methyl-4-oxohexanoate has a molecular weight of 158.20 g/mol, XLogP of 1.16, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 2-methyl-4-oxohexanoate is sourced from PubChem (CID 12593956), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).