About (1R)-1,3-dimethylcyclohexane
(1R)-1,3-dimethylcyclohexane (PubChem CID 12594306) has the molecular formula C8H16
and a molecular weight of 112.22 g/mol. Its IUPAC name is (1R)-1,3-dimethylcyclohexane.
Molecular Properties
| Compound Name | (1R)-1,3-dimethylcyclohexane |
| PubChem CID | 12594306 |
| Molecular Formula | C8H16 |
| Molecular Weight | 112.22 g/mol |
| Exact Mass | 112.13 |
| IUPAC Name | (1R)-1,3-dimethylcyclohexane |
| SMILES | CC1CCC[C@@H](C)C1 |
| InChI | InChI=1S/C8H16/c1-7-4-3-5-8(2)6-7/h7-8H,3-6H2,1-2H3/t7-,8?/m1/s1 |
| InChIKey | SGVUHPSBDNVHKL-GVHYBUMESA-N |
| XLogP | 2.83 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 112.22 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze (1R)-1,3-dimethylcyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R)-1,3-dimethylcyclohexane?
The IUPAC name of (1R)-1,3-dimethylcyclohexane (CID 12594306) is (1R)-1,3-dimethylcyclohexane.
What is the SMILES notation for (1R)-1,3-dimethylcyclohexane?
The canonical SMILES for (1R)-1,3-dimethylcyclohexane is CC1CCC[C@@H](C)C1.
What is the InChIKey of (1R)-1,3-dimethylcyclohexane?
The InChIKey is SGVUHPSBDNVHKL-GVHYBUMESA-N. The full InChI is InChI=1S/C8H16/c1-7-4-3-5-8(2)6-7/h7-8H,3-6H2,1-2H3/t7-,8?/m1/s1.
What are the key properties of (1R)-1,3-dimethylcyclohexane?
(1R)-1,3-dimethylcyclohexane has a molecular weight of 112.22 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (1R)-1,3-dimethylcyclohexane is sourced from PubChem (CID 12594306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).