About 5-(furan-2-yl)pentanoic acid
5-(furan-2-yl)pentanoic acid (PubChem CID 12594357) has the molecular formula C9H12O3
and a molecular weight of 168.19 g/mol. Its IUPAC name is 5-(furan-2-yl)pentanoic acid.
Molecular Properties
| Compound Name | 5-(furan-2-yl)pentanoic acid |
| PubChem CID | 12594357 |
| Molecular Formula | C9H12O3 |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | 5-(furan-2-yl)pentanoic acid |
| SMILES | O=C(O)CCCCc1ccco1 |
| InChI | InChI=1S/C9H12O3/c10-9(11)6-2-1-4-8-5-3-7-12-8/h3,5,7H,1-2,4,6H2,(H,10,11) |
| InChIKey | WXTKIFAAJBAEEH-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(furan-2-yl)pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(furan-2-yl)pentanoic acid?
The IUPAC name of 5-(furan-2-yl)pentanoic acid (CID 12594357) is 5-(furan-2-yl)pentanoic acid.
What is the SMILES notation for 5-(furan-2-yl)pentanoic acid?
The canonical SMILES for 5-(furan-2-yl)pentanoic acid is O=C(O)CCCCc1ccco1.
What is the InChIKey of 5-(furan-2-yl)pentanoic acid?
The InChIKey is WXTKIFAAJBAEEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O3/c10-9(11)6-2-1-4-8-5-3-7-12-8/h3,5,7H,1-2,4,6H2,(H,10,11).
What are the key properties of 5-(furan-2-yl)pentanoic acid?
5-(furan-2-yl)pentanoic acid has a molecular weight of 168.19 g/mol, XLogP of 2.08, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(furan-2-yl)pentanoic acid is sourced from PubChem (CID 12594357), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).