C15H11ClOS — CID 12594399
2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one (PubChem CID 12594399) has the molecular formula C15H11ClOS and a molecular weight of 274.77 g/mol. Its IUPAC name is 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one.
| Compound Name | 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one |
|---|---|
| PubChem CID | 12594399 |
| Molecular Formula | C15H11ClOS |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one |
| SMILES | O=C1CCc2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H11ClOS/c16-11-6-8-15-12(9-11)13(17)7-5-10-3-1-2-4-14(10)18-15/h1-4,6,8-9H,5,7H2 |
| InChIKey | JFYYHCCXEBEWEU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |