About 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one
2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one (PubChem CID 12594399) has the molecular formula C15H11ClOS
and a molecular weight of 274.77 g/mol. Its IUPAC name is 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one.
Molecular Properties
| Compound Name | 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one |
| PubChem CID | 12594399 |
| Molecular Formula | C15H11ClOS |
| Molecular Weight | 274.77 g/mol |
| Exact Mass | 274.02 |
| IUPAC Name | 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one |
| SMILES | O=C1CCc2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C15H11ClOS/c16-11-6-8-15-12(9-11)13(17)7-5-10-3-1-2-4-14(10)18-15/h1-4,6,8-9H,5,7H2 |
| InChIKey | JFYYHCCXEBEWEU-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.77 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one?
The IUPAC name of 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one (CID 12594399) is 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one.
What is the SMILES notation for 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one?
The canonical SMILES for 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one is O=C1CCc2ccccc2Sc2ccc(Cl)cc21.
What is the InChIKey of 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one?
The InChIKey is JFYYHCCXEBEWEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11ClOS/c16-11-6-8-15-12(9-11)13(17)7-5-10-3-1-2-4-14(10)18-15/h1-4,6,8-9H,5,7H2.
What are the key properties of 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one?
2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one has a molecular weight of 274.77 g/mol, XLogP of 4.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-10,11-dihydrobenzo[b][1]benzothiocin-12-one is sourced from PubChem (CID 12594399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).