About 5-chloro-1,2,3,4-tetrahydroisoquinoline
5-chloro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 12595083) has the molecular formula C9H10ClN
and a molecular weight of 167.64 g/mol. Its IUPAC name is 5-chloro-1,2,3,4-tetrahydroisoquinoline.
Molecular Properties
| Compound Name | 5-chloro-1,2,3,4-tetrahydroisoquinoline |
| PubChem CID | 12595083 |
| Molecular Formula | C9H10ClN |
| Molecular Weight | 167.64 g/mol |
| Exact Mass | 167.05 |
| IUPAC Name | 5-chloro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Clc1cccc2c1CCNC2 |
| InChI | InChI=1S/C9H10ClN/c10-9-3-1-2-7-6-11-5-4-8(7)9/h1-3,11H,4-6H2 |
| InChIKey | OHOZWCJUZQXMAW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.64 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-1,2,3,4-tetrahydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-1,2,3,4-tetrahydroisoquinoline?
The IUPAC name of 5-chloro-1,2,3,4-tetrahydroisoquinoline (CID 12595083) is 5-chloro-1,2,3,4-tetrahydroisoquinoline.
What is the SMILES notation for 5-chloro-1,2,3,4-tetrahydroisoquinoline?
The canonical SMILES for 5-chloro-1,2,3,4-tetrahydroisoquinoline is Clc1cccc2c1CCNC2.
What is the InChIKey of 5-chloro-1,2,3,4-tetrahydroisoquinoline?
The InChIKey is OHOZWCJUZQXMAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN/c10-9-3-1-2-7-6-11-5-4-8(7)9/h1-3,11H,4-6H2.
What are the key properties of 5-chloro-1,2,3,4-tetrahydroisoquinoline?
5-chloro-1,2,3,4-tetrahydroisoquinoline has a molecular weight of 167.64 g/mol, XLogP of 1.99, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-1,2,3,4-tetrahydroisoquinoline is sourced from PubChem (CID 12595083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).