C9H8Cl3N — CID 12595086
6,7,8-trichloro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 12595086) has the molecular formula C9H8Cl3N and a molecular weight of 236.53 g/mol. Its IUPAC name is 6,7,8-trichloro-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6,7,8-trichloro-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 12595086 |
| Molecular Formula | C9H8Cl3N |
| Molecular Weight | 236.53 g/mol |
| Exact Mass | 234.97 |
| IUPAC Name | 6,7,8-trichloro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | Clc1cc2c(c(Cl)c1Cl)CNCC2 |
| InChI | InChI=1S/C9H8Cl3N/c10-7-3-5-1-2-13-4-6(5)8(11)9(7)12/h3,13H,1-2,4H2 |
| InChIKey | DYLOZSJRCGMHPX-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.53 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|