ethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate

C17H12Cl2N2O3 — CID 1259542

IUPACethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate
SMILESCCOC(=O)c1ccc(-c2nnc(-c3ccc(Cl)cc3Cl)o2)cc1
InChIInChI=1S/C17H12Cl2N2O3/c1-2-23-17(22)11-5-3-10(4-6-11)15-20-21-16(24-15)13-8-7-12(18)9-14(13)19/h3-9H,2H2,1H3
InChIKeyUFJBHDQRSCWNNT-UHFFFAOYSA-N
MW363.20 g/mol
LogP4.89
Rot. Bonds4

About ethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate

ethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate (PubChem CID 1259542) has the molecular formula C17H12Cl2N2O3 and a molecular weight of 363.20 g/mol. Its IUPAC name is ethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate.

Molecular Properties

Compound Nameethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate
PubChem CID1259542
Molecular FormulaC17H12Cl2N2O3
Molecular Weight363.20 g/mol
Exact Mass362.02
IUPAC Nameethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate
SMILESCCOC(=O)c1ccc(-c2nnc(-c3ccc(Cl)cc3Cl)o2)cc1
InChIInChI=1S/C17H12Cl2N2O3/c1-2-23-17(22)11-5-3-10(4-6-11)15-20-21-16(24-15)13-8-7-12(18)9-14(13)19/h3-9H,2H2,1H3
InChIKeyUFJBHDQRSCWNNT-UHFFFAOYSA-N
XLogP4.89
TPSA65.22 Ų
H-Bond Donors
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms24
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500363.20
LogP ≤ 54.89
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 105

Analyze ethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate?
The IUPAC name of ethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate (CID 1259542) is ethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate.
What is the SMILES notation for ethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate?
The canonical SMILES for ethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate is CCOC(=O)c1ccc(-c2nnc(-c3ccc(Cl)cc3Cl)o2)cc1.
What is the InChIKey of ethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate?
The InChIKey is UFJBHDQRSCWNNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12Cl2N2O3/c1-2-23-17(22)11-5-3-10(4-6-11)15-20-21-16(24-15)13-8-7-12(18)9-14(13)19/h3-9H,2H2,1H3.
What are the key properties of ethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate?
ethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate has a molecular weight of 363.20 g/mol, XLogP of 4.89, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[5-(2,4-dichlorophenyl)-1,3,4-oxadiazol-2-yl]benzoate is sourced from PubChem (CID 1259542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).